C15H10FIN2S — CID 14851833
5-(2-fluorophenyl)-7-iodo-1,3-dihydro-1,4-benzodiazepine-2-thione (PubChem CID 14851833) has the molecular formula C15H10FIN2S and a molecular weight of 396.23 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-7-iodo-1,3-dihydro-1,4-benzodiazepine-2-thione.
| Compound Name | 5-(2-fluorophenyl)-7-iodo-1,3-dihydro-1,4-benzodiazepine-2-thione |
|---|---|
| PubChem CID | 14851833 |
| Molecular Formula | C15H10FIN2S |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 395.96 |
| IUPAC Name | 5-(2-fluorophenyl)-7-iodo-1,3-dihydro-1,4-benzodiazepine-2-thione |
| SMILES | Fc1ccccc1C1=NCC(=S)Nc2ccc(I)cc21 |
| InChI | InChI=1S/C15H10FIN2S/c16-12-4-2-1-3-10(12)15-11-7-9(17)5-6-13(11)19-14(20)8-18-15/h1-7H,8H2,(H,19,20) |
| InChIKey | ITRNMQPSCGAUEL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|