C24H27N3O2Se2 — CID 148520814
N-[5-[benzenecarbonoselenoyl(methyl)amino]-3-(dimethylaminomethylidene)-2,4-dioxopentyl]-N-methylbenzenecarboselenoamide (PubChem CID 148520814) has the molecular formula C24H27N3O2Se2 and a molecular weight of 547.42 g/mol. Its IUPAC name is N-[5-[benzenecarbonoselenoyl(methyl)amino]-3-(dimethylaminomethylidene)-2,4-dioxopentyl]-N-methylbenzenecarboselenoamide.
| Compound Name | N-[5-[benzenecarbonoselenoyl(methyl)amino]-3-(dimethylaminomethylidene)-2,4-dioxopentyl]-N-methylbenzenecarboselenoamide |
|---|---|
| PubChem CID | 148520814 |
| Molecular Formula | C24H27N3O2Se2 |
| Molecular Weight | 547.42 g/mol |
| Exact Mass | 549.04 |
| IUPAC Name | N-[5-[benzenecarbonoselenoyl(methyl)amino]-3-(dimethylaminomethylidene)-2,4-dioxopentyl]-N-methylbenzenecarboselenoamide |
| SMILES | CN(C)C=C(C(=O)CN(C)C(=[Se])c1ccccc1)C(=O)CN(C)C(=[Se])c1ccccc1 |
| InChI | InChI=1S/C24H27N3O2Se2/c1-25(2)15-20(21(28)16-26(3)23(30)18-11-7-5-8-12-18)22(29)17-27(4)24(31)19-13-9-6-10-14-19/h5-15H,16-17H2,1-4H3 |
| InChIKey | MOJFCOUVNPCFCJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|