C23H22N2O4 — CID 11234686
2-[(E)-5-benzoyl-6-(dimethylamino)-4-oxohex-5-enyl]isoindole-1,3-dione (PubChem CID 11234686) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-[(E)-5-benzoyl-6-(dimethylamino)-4-oxohex-5-enyl]isoindole-1,3-dione.
| Compound Name | 2-[(E)-5-benzoyl-6-(dimethylamino)-4-oxohex-5-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11234686 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-[(E)-5-benzoyl-6-(dimethylamino)-4-oxohex-5-enyl]isoindole-1,3-dione |
| SMILES | CN(C)/C=C(\C(=O)CCCN1C(=O)c2ccccc2C1=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O4/c1-24(2)15-19(21(27)16-9-4-3-5-10-16)20(26)13-8-14-25-22(28)17-11-6-7-12-18(17)23(25)29/h3-7,9-12,15H,8,13-14H2,1-2H3/b19-15+ |
| InChIKey | QBNQHARZLAUBOS-XDJHFCHBSA-N |
| XLogP | 2.96 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|