C21H19FN2O5S — CID 70352218
2-[2-[1-(dimethylamino)-3-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]sulfonylethyl]isoindole-1,3-dione (PubChem CID 70352218) has the molecular formula C21H19FN2O5S and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-[2-[1-(dimethylamino)-3-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]sulfonylethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[1-(dimethylamino)-3-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]sulfonylethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70352218 |
| Molecular Formula | C21H19FN2O5S |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-[2-[1-(dimethylamino)-3-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]sulfonylethyl]isoindole-1,3-dione |
| SMILES | CN(C)C=C(C(=O)c1ccc(F)cc1)S(=O)(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H19FN2O5S/c1-23(2)13-18(19(25)14-7-9-15(22)10-8-14)30(28,29)12-11-24-20(26)16-5-3-4-6-17(16)21(24)27/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | LFVXAQMQYPLDOV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|