C6H9NO2 — CID 148524434
(3R)-3-(aminomethyl)-2,3-dihydropyran-6-one (PubChem CID 148524434) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is (3R)-3-(aminomethyl)-2,3-dihydropyran-6-one.
| Compound Name | (3R)-3-(aminomethyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 148524434 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (3R)-3-(aminomethyl)-2,3-dihydropyran-6-one |
| SMILES | NC[C@H]1C=CC(=O)OC1 |
| InChI | InChI=1S/C6H9NO2/c7-3-5-1-2-6(8)9-4-5/h1-2,5H,3-4,7H2/t5-/m1/s1 |
| InChIKey | MPBACNZVOLSPIP-RXMQYKEDSA-N |
| XLogP | -0.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |