C30H50N2O5 — CID 148530607
5-[(1R,2S,5S)-3-(2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclobutylmethyl)-2-hydroxy-5-oxopentanamide (PubChem CID 148530607) has the molecular formula C30H50N2O5 and a molecular weight of 518.74 g/mol. Its IUPAC name is 5-[(1R,2S,5S)-3-(2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclobutylmethyl)-2-hydroxy-5-oxopentanamide.
| Compound Name | 5-[(1R,2S,5S)-3-(2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclobutylmethyl)-2-hydroxy-5-oxopentanamide |
|---|---|
| PubChem CID | 148530607 |
| Molecular Formula | C30H50N2O5 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.37 |
| IUPAC Name | 5-[(1R,2S,5S)-3-(2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclobutylmethyl)-2-hydroxy-5-oxopentanamide |
| SMILES | CC(C)(C)CC(=O)CC(C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)CC(CC1CCC1)C(O)C(N)=O)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C30H50N2O5/c1-28(2,3)15-19(33)14-20(29(4,5)6)27(37)32-16-21-23(30(21,7)8)24(32)22(34)13-18(25(35)26(31)36)12-17-10-9-11-17/h17-18,20-21,23-25,35H,9-16H2,1-8H3,(H2,31,36)/t18?,20?,21-,23-,24+,25?/m0/s1 |
| InChIKey | MQFCMFWYZSDQQD-PRUJRPOHSA-N |
| XLogP | 4.14 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |