C25H42N2O4 — CID 58311263
2-hydroxy-2-[(3S,14R,17S)-3,19,19-trimethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]acetamide (PubChem CID 58311263) has the molecular formula C25H42N2O4 and a molecular weight of 434.62 g/mol. Its IUPAC name is 2-hydroxy-2-[(3S,14R,17S)-3,19,19-trimethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]acetamide.
| Compound Name | 2-hydroxy-2-[(3S,14R,17S)-3,19,19-trimethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]acetamide |
|---|---|
| PubChem CID | 58311263 |
| Molecular Formula | C25H42N2O4 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | 2-hydroxy-2-[(3S,14R,17S)-3,19,19-trimethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]acetamide |
| SMILES | C[C@H]1CCCCCCCCCC[C@@H](C(O)C(N)=O)CC(=O)[C@@H]2C3C(CN2C1=O)C3(C)C |
| InChI | InChI=1S/C25H42N2O4/c1-16-12-10-8-6-4-5-7-9-11-13-17(22(29)23(26)30)14-19(28)21-20-18(25(20,2)3)15-27(21)24(16)31/h16-18,20-22,29H,4-15H2,1-3H3,(H2,26,30)/t16-,17+,18?,20?,21+,22?/m0/s1 |
| InChIKey | PFCCIEPMDOYQQL-UEZWRYGDSA-N |
| XLogP | 3.44 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |