C23H39NO3 — CID 58311347
(3S,13R,16S,17R,19S)-13-(hydroxymethyl)-3,18,18-trimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione (PubChem CID 58311347) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is (3S,13R,16S,17R,19S)-13-(hydroxymethyl)-3,18,18-trimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione.
| Compound Name | (3S,13R,16S,17R,19S)-13-(hydroxymethyl)-3,18,18-trimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione |
|---|---|
| PubChem CID | 58311347 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | (3S,13R,16S,17R,19S)-13-(hydroxymethyl)-3,18,18-trimethyl-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione |
| SMILES | C[C@H]1CCCCCCCCC[C@@H](CO)CC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C |
| InChI | InChI=1S/C23H39NO3/c1-16-11-9-7-5-4-6-8-10-12-17(15-25)13-19(26)21-20-18(23(20,2)3)14-24(21)22(16)27/h16-18,20-21,25H,4-15H2,1-3H3/t16-,17+,18-,20-,21+/m0/s1 |
| InChIKey | ZHDMXQALTVTCKO-WRJHFWDFSA-N |
| XLogP | 4.20 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |