C27H44N2O3 — CID 58311376
2-hydroxy-2-[(3S,14R,17S,18R)-3,4,4,19,19-pentamethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]acetonitrile (PubChem CID 58311376) has the molecular formula C27H44N2O3 and a molecular weight of 444.66 g/mol. Its IUPAC name is 2-hydroxy-2-[(3S,14R,17S,18R)-3,4,4,19,19-pentamethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]acetonitrile.
| Compound Name | 2-hydroxy-2-[(3S,14R,17S,18R)-3,4,4,19,19-pentamethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]acetonitrile |
|---|---|
| PubChem CID | 58311376 |
| Molecular Formula | C27H44N2O3 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | 2-hydroxy-2-[(3S,14R,17S,18R)-3,4,4,19,19-pentamethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]acetonitrile |
| SMILES | C[C@@H]1C(=O)N2CC3[C@@H]([C@H]2C(=O)C[C@H](C(O)C#N)CCCCCCCCCC1(C)C)C3(C)C |
| InChI | InChI=1S/C27H44N2O3/c1-18-25(32)29-17-20-23(27(20,4)5)24(29)21(30)15-19(22(31)16-28)13-11-9-7-6-8-10-12-14-26(18,2)3/h18-20,22-24,31H,6-15,17H2,1-5H3/t18-,19-,20?,22?,23+,24-/m1/s1 |
| InChIKey | BPKDMDDKUQLNNF-OLBIEWIQSA-N |
| XLogP | 5.12 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|