C25H40N2O3 — CID 58311437
2-hydroxy-2-[(3S,14R,17S,18R,20S)-3,19,19-trimethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]acetonitrile (PubChem CID 58311437) has the molecular formula C25H40N2O3 and a molecular weight of 416.61 g/mol. Its IUPAC name is 2-hydroxy-2-[(3S,14R,17S,18R,20S)-3,19,19-trimethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]acetonitrile.
| Compound Name | 2-hydroxy-2-[(3S,14R,17S,18R,20S)-3,19,19-trimethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]acetonitrile |
|---|---|
| PubChem CID | 58311437 |
| Molecular Formula | C25H40N2O3 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | 2-hydroxy-2-[(3S,14R,17S,18R,20S)-3,19,19-trimethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]acetonitrile |
| SMILES | C[C@H]1CCCCCCCCCC[C@@H](C(O)C#N)CC(=O)[C@@H]2[C@@H]3[C@H](CN2C1=O)C3(C)C |
| InChI | InChI=1S/C25H40N2O3/c1-17-12-10-8-6-4-5-7-9-11-13-18(21(29)15-26)14-20(28)23-22-19(25(22,2)3)16-27(23)24(17)30/h17-19,21-23,29H,4-14,16H2,1-3H3/t17-,18+,19-,21?,22-,23+/m0/s1 |
| InChIKey | PSILFHUFEGFTQI-IGIBKXOHSA-N |
| XLogP | 4.48 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|