C9H10F5IO5 — CID 148534487
[1-carboniodidoyloxy-1-(3,3-difluorobutoxy)-2,2,2-trifluoroethyl] acetate (PubChem CID 148534487) has the molecular formula C9H10F5IO5 and a molecular weight of 420.07 g/mol. Its IUPAC name is [1-carboniodidoyloxy-1-(3,3-difluorobutoxy)-2,2,2-trifluoroethyl] acetate.
| Compound Name | [1-carboniodidoyloxy-1-(3,3-difluorobutoxy)-2,2,2-trifluoroethyl] acetate |
|---|---|
| PubChem CID | 148534487 |
| Molecular Formula | C9H10F5IO5 |
| Molecular Weight | 420.07 g/mol |
| Exact Mass | 419.95 |
| IUPAC Name | [1-carboniodidoyloxy-1-(3,3-difluorobutoxy)-2,2,2-trifluoroethyl] acetate |
| SMILES | CC(=O)OC(OCCC(C)(F)F)(OC(=O)I)C(F)(F)F |
| InChI | InChI=1S/C9H10F5IO5/c1-5(16)19-9(8(12,13)14,20-6(15)17)18-4-3-7(2,10)11/h3-4H2,1-2H3 |
| InChIKey | MQXRSEUOCQIJOM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.07 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|