C11H25NO4 — CID 148541643
1-[2-hydroxyethyl-[2-(2-hydroxypropoxy)propyl]amino]propan-2-ol (PubChem CID 148541643) has the molecular formula C11H25NO4 and a molecular weight of 235.32 g/mol. Its IUPAC name is 1-[2-hydroxyethyl-[2-(2-hydroxypropoxy)propyl]amino]propan-2-ol.
| Compound Name | 1-[2-hydroxyethyl-[2-(2-hydroxypropoxy)propyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 148541643 |
| Molecular Formula | C11H25NO4 |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 1-[2-hydroxyethyl-[2-(2-hydroxypropoxy)propyl]amino]propan-2-ol |
| SMILES | CC(O)COC(C)CN(CCO)CC(C)O |
| InChI | InChI=1S/C11H25NO4/c1-9(14)6-12(4-5-13)7-11(3)16-8-10(2)15/h9-11,13-15H,4-8H2,1-3H3 |
| InChIKey | MSGYNKFSIFODSY-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |