C14H35N3O3 — CID 162147742
N-[2-(dimethylamino)ethyl]-N',N'-dimethylethane-1,2-diamine;2-(2-hydroxypropoxy)propan-1-ol (PubChem CID 162147742) has the molecular formula C14H35N3O3 and a molecular weight of 293.45 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N',N'-dimethylethane-1,2-diamine;2-(2-hydroxypropoxy)propan-1-ol.
| Compound Name | N-[2-(dimethylamino)ethyl]-N',N'-dimethylethane-1,2-diamine;2-(2-hydroxypropoxy)propan-1-ol |
|---|---|
| PubChem CID | 162147742 |
| Molecular Formula | C14H35N3O3 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N',N'-dimethylethane-1,2-diamine;2-(2-hydroxypropoxy)propan-1-ol |
| SMILES | CC(O)COC(C)CO.CN(C)CCNCCN(C)C |
| InChI | InChI=1S/C8H21N3.C6H14O3/c1-10(2)7-5-9-6-8-11(3)4;1-5(8)4-9-6(2)3-7/h9H,5-8H2,1-4H3;5-8H,3-4H2,1-2H3 |
| InChIKey | ZKUDAACWCJGVFF-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 68.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|