C18H15F3O3 — CID 148564495
2,3,6-trifluoro-4-[(4-methylphenyl)methoxy]-5-[(E)-prop-1-enyl]benzoic acid (PubChem CID 148564495) has the molecular formula C18H15F3O3 and a molecular weight of 336.31 g/mol. Its IUPAC name is 2,3,6-trifluoro-4-[(4-methylphenyl)methoxy]-5-[(E)-prop-1-enyl]benzoic acid.
| Compound Name | 2,3,6-trifluoro-4-[(4-methylphenyl)methoxy]-5-[(E)-prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 148564495 |
| Molecular Formula | C18H15F3O3 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2,3,6-trifluoro-4-[(4-methylphenyl)methoxy]-5-[(E)-prop-1-enyl]benzoic acid |
| SMILES | C/C=C/c1c(F)c(C(=O)O)c(F)c(F)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C18H15F3O3/c1-3-4-12-14(19)13(18(22)23)15(20)16(21)17(12)24-9-11-7-5-10(2)6-8-11/h3-8H,9H2,1-2H3,(H,22,23)/b4-3+ |
| InChIKey | MVQJYGAXSSZEAH-ONEGZZNKSA-N |
| XLogP | 4.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|