C23H15F4NO4 — CID 21337161
2-[[2,3,5,6-tetrafluoro-4-[(4-methylphenyl)methoxy]phenyl]methoxy]isoindole-1,3-dione (PubChem CID 21337161) has the molecular formula C23H15F4NO4 and a molecular weight of 445.37 g/mol. Its IUPAC name is 2-[[2,3,5,6-tetrafluoro-4-[(4-methylphenyl)methoxy]phenyl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-[[2,3,5,6-tetrafluoro-4-[(4-methylphenyl)methoxy]phenyl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21337161 |
| Molecular Formula | C23H15F4NO4 |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 2-[[2,3,5,6-tetrafluoro-4-[(4-methylphenyl)methoxy]phenyl]methoxy]isoindole-1,3-dione |
| SMILES | Cc1ccc(COc2c(F)c(F)c(CON3C(=O)c4ccccc4C3=O)c(F)c2F)cc1 |
| InChI | InChI=1S/C23H15F4NO4/c1-12-6-8-13(9-7-12)10-31-21-19(26)17(24)16(18(25)20(21)27)11-32-28-22(29)14-4-2-3-5-15(14)23(28)30/h2-9H,10-11H2,1H3 |
| InChIKey | BIDJDDPUSZEZPI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|