C26H25NO4 — CID 14857356
ethyl 4-(1-benzyl-2-oxo-3-pyridinyl)-2,2-dimethylchromene-6-carboxylate (PubChem CID 14857356) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is ethyl 4-(1-benzyl-2-oxo-3-pyridinyl)-2,2-dimethylchromene-6-carboxylate.
| Compound Name | ethyl 4-(1-benzyl-2-oxo-3-pyridinyl)-2,2-dimethylchromene-6-carboxylate |
|---|---|
| PubChem CID | 14857356 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | ethyl 4-(1-benzyl-2-oxo-3-pyridinyl)-2,2-dimethylchromene-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)C(c1cccn(Cc3ccccc3)c1=O)=CC(C)(C)O2 |
| InChI | InChI=1S/C26H25NO4/c1-4-30-25(29)19-12-13-23-21(15-19)22(16-26(2,3)31-23)20-11-8-14-27(24(20)28)17-18-9-6-5-7-10-18/h5-16H,4,17H2,1-3H3 |
| InChIKey | RAAMUWHTNWZLPG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |