C19H26INO5 — CID 148605244
tert-butyl 4-[4-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-4-oxobutanoate (PubChem CID 148605244) has the molecular formula C19H26INO5 and a molecular weight of 475.32 g/mol. Its IUPAC name is tert-butyl 4-[4-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-4-oxobutanoate.
| Compound Name | tert-butyl 4-[4-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 148605244 |
| Molecular Formula | C19H26INO5 |
| Molecular Weight | 475.32 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | tert-butyl 4-[4-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)CCC(=O)c1ccc(I)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26INO5/c1-18(2,3)25-16(23)10-9-15(22)13-8-7-12(20)11-14(13)21-17(24)26-19(4,5)6/h7-8,11H,9-10H2,1-6H3,(H,21,24) |
| InChIKey | NDGVMNLNMDFPJC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|