C24H35IN2O7 — CID 118145538
tert-butyl (2S)-4-[5-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (PubChem CID 118145538) has the molecular formula C24H35IN2O7 and a molecular weight of 590.46 g/mol. Its IUPAC name is tert-butyl (2S)-4-[5-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate.
| Compound Name | tert-butyl (2S)-4-[5-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 118145538 |
| Molecular Formula | C24H35IN2O7 |
| Molecular Weight | 590.46 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | tert-butyl (2S)-4-[5-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(I)cc1C(=O)C[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H35IN2O7/c1-22(2,3)32-19(29)17(27-21(31)34-24(7,8)9)13-18(28)15-12-14(25)10-11-16(15)26-20(30)33-23(4,5)6/h10-12,17H,13H2,1-9H3,(H,26,30)(H,27,31)/t17-/m0/s1 |
| InChIKey | FAGXRSBCDZPFMO-KRWDZBQOSA-N |
| XLogP | 5.45 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|