C21H30INO7 — CID 138705626
ditert-butyl butanedioate;methyl 4-carbamoyl-2-iodobenzoate (PubChem CID 138705626) has the molecular formula C21H30INO7 and a molecular weight of 535.38 g/mol. Its IUPAC name is ditert-butyl butanedioate;methyl 4-carbamoyl-2-iodobenzoate.
| Compound Name | ditert-butyl butanedioate;methyl 4-carbamoyl-2-iodobenzoate |
|---|---|
| PubChem CID | 138705626 |
| Molecular Formula | C21H30INO7 |
| Molecular Weight | 535.38 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | ditert-butyl butanedioate;methyl 4-carbamoyl-2-iodobenzoate |
| SMILES | CC(C)(C)OC(=O)CCC(=O)OC(C)(C)C.COC(=O)c1ccc(C(N)=O)cc1I |
| InChI | InChI=1S/C12H22O4.C9H8INO3/c1-11(2,3)15-9(13)7-8-10(14)16-12(4,5)6;1-14-9(13)6-3-2-5(8(11)12)4-7(6)10/h7-8H2,1-6H3;2-4H,1H3,(H2,11,12) |
| InChIKey | WKXVHZDRIZFHLT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|