C7H7BN2O — CID 148618556
CID 148618556 (PubChem CID 148618556) has the molecular formula C7H7BN2O and a molecular weight of 145.96 g/mol.
| Compound Name | CID 148618556 |
|---|---|
| PubChem CID | 148618556 |
| Molecular Formula | C7H7BN2O |
| Molecular Weight | 145.96 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | — |
| SMILES | [B]C1Oc2cccnc2C1N |
| InChI | InChI=1S/C7H7BN2O/c8-7-5(9)6-4(11-7)2-1-3-10-6/h1-3,5,7H,9H2 |
| InChIKey | OMJYXLFMXIQQPM-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.96 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|