C8H9N3OS — CID 167004975
(3S)-3-amino-3,5-dihydro-2H-pyrido[3,2-b][1,4]oxazepine-4-thione (PubChem CID 167004975) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is (3S)-3-amino-3,5-dihydro-2H-pyrido[3,2-b][1,4]oxazepine-4-thione.
| Compound Name | (3S)-3-amino-3,5-dihydro-2H-pyrido[3,2-b][1,4]oxazepine-4-thione |
|---|---|
| PubChem CID | 167004975 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | (3S)-3-amino-3,5-dihydro-2H-pyrido[3,2-b][1,4]oxazepine-4-thione |
| SMILES | N[C@H]1COc2cccnc2NC1=S |
| InChI | InChI=1S/C8H9N3OS/c9-5-4-12-6-2-1-3-10-7(6)11-8(5)13/h1-3,5H,4,9H2,(H,10,11,13)/t5-/m0/s1 |
| InChIKey | FTXDARKOZXCAII-YFKPBYRVSA-N |
| XLogP | 0.54 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|