C23H23BF3N7O2 — CID 148626111
N-(4-methylpyrimidin-2-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]indazol-5-amine (PubChem CID 148626111) has the molecular formula C23H23BF3N7O2 and a molecular weight of 497.29 g/mol. Its IUPAC name is N-(4-methylpyrimidin-2-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]indazol-5-amine.
| Compound Name | N-(4-methylpyrimidin-2-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]indazol-5-amine |
|---|---|
| PubChem CID | 148626111 |
| Molecular Formula | C23H23BF3N7O2 |
| Molecular Weight | 497.29 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | N-(4-methylpyrimidin-2-yl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(trifluoromethyl)pyrimidin-2-yl]indazol-5-amine |
| SMILES | Cc1ccnc(Nc2cc(B3OC(C)(C)C(C)(C)O3)c3c(cnn3-c3nccc(C(F)(F)F)n3)c2)n1 |
| InChI | InChI=1S/C23H23BF3N7O2/c1-13-6-8-28-19(31-13)32-15-10-14-12-30-34(20-29-9-7-17(33-20)23(25,26)27)18(14)16(11-15)24-35-21(2,3)22(4,5)36-24/h6-12H,1-5H3,(H,28,31,32) |
| InChIKey | NHFQXXFCYGJOER-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|