C8H8F3N — CID 148638145
1-cyclohexa-2,4-dien-1-yl-2,2,2-trifluoroethanimine (PubChem CID 148638145) has the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-yl-2,2,2-trifluoroethanimine.
| Compound Name | 1-cyclohexa-2,4-dien-1-yl-2,2,2-trifluoroethanimine |
|---|---|
| PubChem CID | 148638145 |
| Molecular Formula | C8H8F3N |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-yl-2,2,2-trifluoroethanimine |
| SMILES | [H]/N=C(\C1C=CC=CC1)C(F)(F)F |
| InChI | InChI=1S/C8H8F3N/c9-8(10,11)7(12)6-4-2-1-3-5-6/h1-4,6,12H,5H2/b12-7+ |
| InChIKey | NJMHUSDWUZVUHZ-KPKJPENVSA-N |
| XLogP | 2.70 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|