(2,10-dimethyl-4-oxoundecan-6-yl) acetate

C15H28O3 — CID 148647340

IUPAC(2,10-dimethyl-4-oxoundecan-6-yl) acetate
SMILESCC(=O)OC(CCCC(C)C)CC(=O)CC(C)C
InChIInChI=1S/C15H28O3/c1-11(2)7-6-8-15(18-13(5)16)10-14(17)9-12(3)4/h11-12,15H,6-10H2,1-5H3
InChIKeyNLFKEDKJQYUNQE-UHFFFAOYSA-N
MW256.39 g/mol
LogP3.75
Rot. Bonds9

About (2,10-dimethyl-4-oxoundecan-6-yl) acetate

(2,10-dimethyl-4-oxoundecan-6-yl) acetate (PubChem CID 148647340) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (2,10-dimethyl-4-oxoundecan-6-yl) acetate.

Molecular Properties

Compound Name(2,10-dimethyl-4-oxoundecan-6-yl) acetate
PubChem CID148647340
Molecular FormulaC15H28O3
Molecular Weight256.39 g/mol
Exact Mass256.20
IUPAC Name(2,10-dimethyl-4-oxoundecan-6-yl) acetate
SMILESCC(=O)OC(CCCC(C)C)CC(=O)CC(C)C
InChIInChI=1S/C15H28O3/c1-11(2)7-6-8-15(18-13(5)16)10-14(17)9-12(3)4/h11-12,15H,6-10H2,1-5H3
InChIKeyNLFKEDKJQYUNQE-UHFFFAOYSA-N
XLogP3.75
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.39
LogP ≤ 53.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (2,10-dimethyl-4-oxoundecan-6-yl) acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,10-dimethyl-4-oxoundecan-6-yl) acetate?
The IUPAC name of (2,10-dimethyl-4-oxoundecan-6-yl) acetate (CID 148647340) is (2,10-dimethyl-4-oxoundecan-6-yl) acetate.
What is the SMILES notation for (2,10-dimethyl-4-oxoundecan-6-yl) acetate?
The canonical SMILES for (2,10-dimethyl-4-oxoundecan-6-yl) acetate is CC(=O)OC(CCCC(C)C)CC(=O)CC(C)C.
What is the InChIKey of (2,10-dimethyl-4-oxoundecan-6-yl) acetate?
The InChIKey is NLFKEDKJQYUNQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3/c1-11(2)7-6-8-15(18-13(5)16)10-14(17)9-12(3)4/h11-12,15H,6-10H2,1-5H3.
What are the key properties of (2,10-dimethyl-4-oxoundecan-6-yl) acetate?
(2,10-dimethyl-4-oxoundecan-6-yl) acetate has a molecular weight of 256.39 g/mol, XLogP of 3.75, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,10-dimethyl-4-oxoundecan-6-yl) acetate is sourced from PubChem (CID 148647340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).