C15H28O3 — CID 148647340
(2,10-dimethyl-4-oxoundecan-6-yl) acetate (PubChem CID 148647340) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (2,10-dimethyl-4-oxoundecan-6-yl) acetate.
| Compound Name | (2,10-dimethyl-4-oxoundecan-6-yl) acetate |
|---|---|
| PubChem CID | 148647340 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (2,10-dimethyl-4-oxoundecan-6-yl) acetate |
| SMILES | CC(=O)OC(CCCC(C)C)CC(=O)CC(C)C |
| InChI | InChI=1S/C15H28O3/c1-11(2)7-6-8-15(18-13(5)16)10-14(17)9-12(3)4/h11-12,15H,6-10H2,1-5H3 |
| InChIKey | NLFKEDKJQYUNQE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |