C24H35N2O15P3Si — CID 148648133
[[(2R,5R)-5-[2,4-dioxo-5-[2-[phenylmethoxy-di(propan-2-yl)silyl]ethynyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 148648133) has the molecular formula C24H35N2O15P3Si and a molecular weight of 712.55 g/mol. Its IUPAC name is [[(2R,5R)-5-[2,4-dioxo-5-[2-[phenylmethoxy-di(propan-2-yl)silyl]ethynyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-[2,4-dioxo-5-[2-[phenylmethoxy-di(propan-2-yl)silyl]ethynyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 148648133 |
| Molecular Formula | C24H35N2O15P3Si |
| Molecular Weight | 712.55 g/mol |
| Exact Mass | 712.10 |
| IUPAC Name | [[(2R,5R)-5-[2,4-dioxo-5-[2-[phenylmethoxy-di(propan-2-yl)silyl]ethynyl]pyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(C)[Si](C#Cc1cn([C@H]2CC(O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O)(OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C24H35N2O15P3Si/c1-16(2)45(17(3)4,38-14-18-8-6-5-7-9-18)11-10-19-13-26(24(29)25-23(19)28)22-12-20(27)21(39-22)15-37-43(33,34)41-44(35,36)40-42(30,31)32/h5-9,13,16-17,20-22,27H,12,14-15H2,1-4H3,(H,33,34)(H,35,36)(H,25,28,29)(H2,30,31,32)/t20?,21-,22-/m1/s1 |
| InChIKey | NLJMODXAHPFNIP-HRUVVLKGSA-N |
| XLogP | 2.40 |
| TPSA | 253.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|