C12H24N2O2S — CID 148653650
3-[3-[3-(oxiran-2-ylmethoxy)propyl]imidazolidin-1-yl]propane-1-thiol (PubChem CID 148653650) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is 3-[3-[3-(oxiran-2-ylmethoxy)propyl]imidazolidin-1-yl]propane-1-thiol.
| Compound Name | 3-[3-[3-(oxiran-2-ylmethoxy)propyl]imidazolidin-1-yl]propane-1-thiol |
|---|---|
| PubChem CID | 148653650 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3-[3-[3-(oxiran-2-ylmethoxy)propyl]imidazolidin-1-yl]propane-1-thiol |
| SMILES | SCCCN1CCN(CCCOCC2CO2)C1 |
| InChI | InChI=1S/C12H24N2O2S/c17-8-2-4-14-6-5-13(11-14)3-1-7-15-9-12-10-16-12/h12,17H,1-11H2 |
| InChIKey | NMJYFLGGKNRDMZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 28.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|