C7H14N2S2 — CID 148682528
2-N,3-N-bis(methylsulfanyl)pentane-2,3-diimine (PubChem CID 148682528) has the molecular formula C7H14N2S2 and a molecular weight of 190.34 g/mol. Its IUPAC name is 2-N,3-N-bis(methylsulfanyl)pentane-2,3-diimine.
| Compound Name | 2-N,3-N-bis(methylsulfanyl)pentane-2,3-diimine |
|---|---|
| PubChem CID | 148682528 |
| Molecular Formula | C7H14N2S2 |
| Molecular Weight | 190.34 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2-N,3-N-bis(methylsulfanyl)pentane-2,3-diimine |
| SMILES | CCC(=NSC)C(C)=NSC |
| InChI | InChI=1S/C7H14N2S2/c1-5-7(9-11-4)6(2)8-10-3/h5H2,1-4H3 |
| InChIKey | NRXBPBPJDJWSPW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|