C5H10N2S — CID 129072956
3-N-methylsulfanylbutane-2,3-diimine (PubChem CID 129072956) has the molecular formula C5H10N2S and a molecular weight of 130.22 g/mol. Its IUPAC name is 3-N-methylsulfanylbutane-2,3-diimine.
| Compound Name | 3-N-methylsulfanylbutane-2,3-diimine |
|---|---|
| PubChem CID | 129072956 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 3-N-methylsulfanylbutane-2,3-diimine |
| SMILES | [H]/N=C(C)/C(C)=N\SC |
| InChI | InChI=1S/C5H10N2S/c1-4(6)5(2)7-8-3/h6H,1-3H3/b6-4+,7-5- |
| InChIKey | ZJVONKLAPFZTBM-GUBXDBFYSA-N |
| XLogP | 1.76 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|