About (propan-2-ylideneamino) methanimidothioate
(propan-2-ylideneamino) methanimidothioate (PubChem CID 143221531) has the molecular formula C4H8N2S
and a molecular weight of 116.19 g/mol. Its IUPAC name is (propan-2-ylideneamino) methanimidothioate.
Molecular Properties
| Compound Name | (propan-2-ylideneamino) methanimidothioate |
| PubChem CID | 143221531 |
| Molecular Formula | C4H8N2S |
| Molecular Weight | 116.19 g/mol |
| Exact Mass | 116.04 |
| IUPAC Name | (propan-2-ylideneamino) methanimidothioate |
| SMILES | [H]/N=C/SN=C(C)C |
| InChI | InChI=1S/C4H8N2S/c1-4(2)6-7-3-5/h3,5H,1-2H3/b5-3+ |
| InChIKey | LTDLBBPPPLDVRJ-HWKANZROSA-N |
| XLogP | 1.72 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (propan-2-ylideneamino) methanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propan-2-ylideneamino) methanimidothioate?
The IUPAC name of (propan-2-ylideneamino) methanimidothioate (CID 143221531) is (propan-2-ylideneamino) methanimidothioate.
What is the SMILES notation for (propan-2-ylideneamino) methanimidothioate?
The canonical SMILES for (propan-2-ylideneamino) methanimidothioate is [H]/N=C/SN=C(C)C.
What is the InChIKey of (propan-2-ylideneamino) methanimidothioate?
The InChIKey is LTDLBBPPPLDVRJ-HWKANZROSA-N. The full InChI is InChI=1S/C4H8N2S/c1-4(2)6-7-3-5/h3,5H,1-2H3/b5-3+.
What are the key properties of (propan-2-ylideneamino) methanimidothioate?
(propan-2-ylideneamino) methanimidothioate has a molecular weight of 116.19 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (propan-2-ylideneamino) methanimidothioate is sourced from PubChem (CID 143221531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).