C15H15F3O2 — CID 148685225
5-[3-methyl-5-(trifluoromethyl)phenyl]-6-oxaspiro[3.4]octan-7-one (PubChem CID 148685225) has the molecular formula C15H15F3O2 and a molecular weight of 284.28 g/mol. Its IUPAC name is 5-[3-methyl-5-(trifluoromethyl)phenyl]-6-oxaspiro[3.4]octan-7-one.
| Compound Name | 5-[3-methyl-5-(trifluoromethyl)phenyl]-6-oxaspiro[3.4]octan-7-one |
|---|---|
| PubChem CID | 148685225 |
| Molecular Formula | C15H15F3O2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 5-[3-methyl-5-(trifluoromethyl)phenyl]-6-oxaspiro[3.4]octan-7-one |
| SMILES | Cc1cc(C2OC(=O)CC23CCC3)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F3O2/c1-9-5-10(7-11(6-9)15(16,17)18)13-14(3-2-4-14)8-12(19)20-13/h5-7,13H,2-4,8H2,1H3 |
| InChIKey | NSKGAWJEAHFNCP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |