About 5-Chlorosalicylanilide
5-Chlorosalicylanilide (PubChem CID 14869) has the molecular formula C13H10ClNO2
and a molecular weight of 247.67 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N-phenylbenzamide.
Molecular Properties
| Compound Name | 5-Chlorosalicylanilide |
| PubChem CID | 14869 |
| Molecular Formula | C13H10ClNO2 |
| Molecular Weight | 247.67 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 5-chloro-2-hydroxy-N-phenylbenzamide |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=C(C=CC(=C2)Cl)O |
| InChI | InChI=1S/C13H10ClNO2/c14-9-6-7-12(16)11(8-9)13(17)15-10-4-2-1-3-5-10/h1-8,16H,(H,15,17) |
| InChIKey | KGYNGVVNFRUOOZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 266 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.67 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-Chlorosalicylanilide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-Chlorosalicylanilide?
The IUPAC name of 5-Chlorosalicylanilide (CID 14869) is 5-chloro-2-hydroxy-N-phenylbenzamide.
What is the SMILES notation for 5-Chlorosalicylanilide?
The canonical SMILES for 5-Chlorosalicylanilide is C1=CC=C(C=C1)NC(=O)C2=C(C=CC(=C2)Cl)O.
What is the InChIKey of 5-Chlorosalicylanilide?
The InChIKey is KGYNGVVNFRUOOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClNO2/c14-9-6-7-12(16)11(8-9)13(17)15-10-4-2-1-3-5-10/h1-8,16H,(H,15,17).
What are the key properties of 5-Chlorosalicylanilide?
5-Chlorosalicylanilide has a molecular weight of 247.67 g/mol, XLogP of 3.90, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-Chlorosalicylanilide is sourced from PubChem (CID 14869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).