About 4',5-Dichlorosalicylanilide
4',5-Dichlorosalicylanilide (PubChem CID 24326) has the molecular formula C13H9Cl2NO2
and a molecular weight of 282.12 g/mol. Its IUPAC name is 5-chloro-N-(4-chlorophenyl)-2-hydroxybenzamide.
Molecular Properties
| Compound Name | 4',5-Dichlorosalicylanilide |
| PubChem CID | 24326 |
| Molecular Formula | C13H9Cl2NO2 |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 5-chloro-N-(4-chlorophenyl)-2-hydroxybenzamide |
| SMILES | C1=CC(=CC=C1NC(=O)C2=C(C=CC(=C2)Cl)O)Cl |
| InChI | InChI=1S/C13H9Cl2NO2/c14-8-1-4-10(5-2-8)16-13(18)11-7-9(15)3-6-12(11)17/h1-7,17H,(H,16,18) |
| InChIKey | PVWWOFBIYKSBEX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | 293 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4',5-Dichlorosalicylanilide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4',5-Dichlorosalicylanilide?
The IUPAC name of 4',5-Dichlorosalicylanilide (CID 24326) is 5-chloro-N-(4-chlorophenyl)-2-hydroxybenzamide.
What is the SMILES notation for 4',5-Dichlorosalicylanilide?
The canonical SMILES for 4',5-Dichlorosalicylanilide is C1=CC(=CC=C1NC(=O)C2=C(C=CC(=C2)Cl)O)Cl.
What is the InChIKey of 4',5-Dichlorosalicylanilide?
The InChIKey is PVWWOFBIYKSBEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2NO2/c14-8-1-4-10(5-2-8)16-13(18)11-7-9(15)3-6-12(11)17/h1-7,17H,(H,16,18).
What are the key properties of 4',5-Dichlorosalicylanilide?
4',5-Dichlorosalicylanilide has a molecular weight of 282.12 g/mol, XLogP of 4.50, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4',5-Dichlorosalicylanilide is sourced from PubChem (CID 24326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).