C14H17ClFNO — CID 148692732
1-[(2-chloro-4-fluorophenyl)methylideneamino]-4,4-dimethylpentan-2-one (PubChem CID 148692732) has the molecular formula C14H17ClFNO and a molecular weight of 269.75 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methylideneamino]-4,4-dimethylpentan-2-one.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methylideneamino]-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 148692732 |
| Molecular Formula | C14H17ClFNO |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methylideneamino]-4,4-dimethylpentan-2-one |
| SMILES | CC(C)(C)CC(=O)C/N=C/c1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H17ClFNO/c1-14(2,3)7-12(18)9-17-8-10-4-5-11(16)6-13(10)15/h4-6,8H,7,9H2,1-3H3/b17-8+ |
| InChIKey | NTUOWEFIVNMUNH-CAOOACKPSA-N |
| XLogP | 3.90 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|