C10H8ClN3O2S — CID 1486940
2-chloro-N-(2-methyl-3-oxo-1,2,4-thiadiazol-5-yl)benzamide (PubChem CID 1486940) has the molecular formula C10H8ClN3O2S and a molecular weight of 269.71 g/mol. Its IUPAC name is 2-chloro-N-(2-methyl-3-oxo-1,2,4-thiadiazol-5-yl)benzamide.
| Compound Name | 2-chloro-N-(2-methyl-3-oxo-1,2,4-thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 1486940 |
| Molecular Formula | C10H8ClN3O2S |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 2-chloro-N-(2-methyl-3-oxo-1,2,4-thiadiazol-5-yl)benzamide |
| SMILES | Cn1sc(NC(=O)c2ccccc2Cl)nc1=O |
| InChI | InChI=1S/C10H8ClN3O2S/c1-14-10(16)13-9(17-14)12-8(15)6-4-2-3-5-7(6)11/h2-5H,1H3,(H,12,13,15,16) |
| InChIKey | NQGOLXWPOMFDOL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |