C11H11ClN4O — CID 75503905
2-chloro-N-(4,5-dimethyl-1,2,4-triazol-3-yl)benzamide (PubChem CID 75503905) has the molecular formula C11H11ClN4O and a molecular weight of 250.69 g/mol. Its IUPAC name is 2-chloro-N-(4,5-dimethyl-1,2,4-triazol-3-yl)benzamide.
| Compound Name | 2-chloro-N-(4,5-dimethyl-1,2,4-triazol-3-yl)benzamide |
|---|---|
| PubChem CID | 75503905 |
| Molecular Formula | C11H11ClN4O |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-chloro-N-(4,5-dimethyl-1,2,4-triazol-3-yl)benzamide |
| SMILES | Cc1nnc(NC(=O)c2ccccc2Cl)n1C |
| InChI | InChI=1S/C11H11ClN4O/c1-7-14-15-11(16(7)2)13-10(17)8-5-3-4-6-9(8)12/h3-6H,1-2H3,(H,13,15,17) |
| InChIKey | JLHGKIHJCXMLGH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |