C9H8N2 — CID 14869778
2-[(2E,4E)-hexa-2,4-dienylidene]propanedinitrile (PubChem CID 14869778) has the molecular formula C9H8N2 and a molecular weight of 144.18 g/mol. Its IUPAC name is 2-[(2E,4E)-hexa-2,4-dienylidene]propanedinitrile.
| Compound Name | 2-[(2E,4E)-hexa-2,4-dienylidene]propanedinitrile |
|---|---|
| PubChem CID | 14869778 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 2-[(2E,4E)-hexa-2,4-dienylidene]propanedinitrile |
| SMILES | C/C=C/C=C/C=C(C#N)C#N |
| InChI | InChI=1S/C9H8N2/c1-2-3-4-5-6-9(7-10)8-11/h2-6H,1H3/b3-2+,5-4+ |
| InChIKey | OABFQXSDBOEBKP-MQQKCMAXSA-N |
| XLogP | 2.09 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|