C8H11N — CID 22034628
buta-1,3-diene;2-methylprop-2-enenitrile (PubChem CID 22034628) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is buta-1,3-diene;2-methylprop-2-enenitrile.
| Compound Name | buta-1,3-diene;2-methylprop-2-enenitrile |
|---|---|
| PubChem CID | 22034628 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | buta-1,3-diene;2-methylprop-2-enenitrile |
| SMILES | C=C(C)C#N.C=CC=C |
| InChI | InChI=1S/C4H5N.C4H6/c1-4(2)3-5;1-3-4-2/h1H2,2H3;3-4H,1-2H2 |
| InChIKey | SCUWTOMKAPTAND-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|