C12H19ClN2O2 — CID 148706747
[[3-(chloromethyl)-1,2-oxazol-5-yl]methylamino]-cyclohexylmethanol (PubChem CID 148706747) has the molecular formula C12H19ClN2O2 and a molecular weight of 258.75 g/mol. Its IUPAC name is [[3-(chloromethyl)-1,2-oxazol-5-yl]methylamino]-cyclohexylmethanol.
| Compound Name | [[3-(chloromethyl)-1,2-oxazol-5-yl]methylamino]-cyclohexylmethanol |
|---|---|
| PubChem CID | 148706747 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | [[3-(chloromethyl)-1,2-oxazol-5-yl]methylamino]-cyclohexylmethanol |
| SMILES | OC(NCc1cc(CCl)no1)C1CCCCC1 |
| InChI | InChI=1S/C12H19ClN2O2/c13-7-10-6-11(17-15-10)8-14-12(16)9-4-2-1-3-5-9/h6,9,12,14,16H,1-5,7-8H2 |
| InChIKey | NWKUXIUWMJCXNN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|