C8H10ClNO — CID 166559907
5-(chloromethyl)-3-(cyclopropylmethyl)-1,2-oxazole (PubChem CID 166559907) has the molecular formula C8H10ClNO and a molecular weight of 171.63 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(cyclopropylmethyl)-1,2-oxazole.
| Compound Name | 5-(chloromethyl)-3-(cyclopropylmethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 166559907 |
| Molecular Formula | C8H10ClNO |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 5-(chloromethyl)-3-(cyclopropylmethyl)-1,2-oxazole |
| SMILES | ClCc1cc(CC2CC2)no1 |
| InChI | InChI=1S/C8H10ClNO/c9-5-8-4-7(10-11-8)3-6-1-2-6/h4,6H,1-3,5H2 |
| InChIKey | FJMXJSHHIWBXEM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|