C29H29N3O3 — CID 148740531
4-[[3-[2-(diethylamino)ethoxy]-5-[2-(4-isocyanophenyl)acetyl]phenoxy]methyl]benzonitrile (PubChem CID 148740531) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 4-[[3-[2-(diethylamino)ethoxy]-5-[2-(4-isocyanophenyl)acetyl]phenoxy]methyl]benzonitrile.
| Compound Name | 4-[[3-[2-(diethylamino)ethoxy]-5-[2-(4-isocyanophenyl)acetyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 148740531 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 4-[[3-[2-(diethylamino)ethoxy]-5-[2-(4-isocyanophenyl)acetyl]phenoxy]methyl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(CC(=O)c2cc(OCCN(CC)CC)cc(OCc3ccc(C#N)cc3)c2)cc1 |
| InChI | InChI=1S/C29H29N3O3/c1-4-32(5-2)14-15-34-27-17-25(29(33)16-22-10-12-26(31-3)13-11-22)18-28(19-27)35-21-24-8-6-23(20-30)7-9-24/h6-13,17-19H,4-5,14-16,21H2,1-2H3 |
| InChIKey | OCSYYPWQWFBBMU-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|