C27H25N3O4 — CID 58636743
ethyl 3-[5-[(4-cyanophenoxy)methyl]-3-[(4-isocyanophenyl)methoxy]-2-methyl-4-pyridinyl]propanoate (PubChem CID 58636743) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is ethyl 3-[5-[(4-cyanophenoxy)methyl]-3-[(4-isocyanophenyl)methoxy]-2-methyl-4-pyridinyl]propanoate.
| Compound Name | ethyl 3-[5-[(4-cyanophenoxy)methyl]-3-[(4-isocyanophenyl)methoxy]-2-methyl-4-pyridinyl]propanoate |
|---|---|
| PubChem CID | 58636743 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | ethyl 3-[5-[(4-cyanophenoxy)methyl]-3-[(4-isocyanophenyl)methoxy]-2-methyl-4-pyridinyl]propanoate |
| SMILES | [C-]#[N+]c1ccc(COc2c(C)ncc(COc3ccc(C#N)cc3)c2CCC(=O)OCC)cc1 |
| InChI | InChI=1S/C27H25N3O4/c1-4-32-26(31)14-13-25-22(18-33-24-11-7-20(15-28)8-12-24)16-30-19(2)27(25)34-17-21-5-9-23(29-3)10-6-21/h5-12,16H,4,13-14,17-18H2,1-2H3 |
| InChIKey | VQORDKKOKWYWPB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|