C21H19Cl2F6N2O2S+ — CID 148741495
[(2S)-2-(3,5-dichlorophenyl)-1,1,1-trifluoro-4-imino-4-[3-methyl-4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylphenyl]butan-2-yl]oxidanium (PubChem CID 148741495) has the molecular formula C21H19Cl2F6N2O2S+ and a molecular weight of 548.36 g/mol. Its IUPAC name is [(2S)-2-(3,5-dichlorophenyl)-1,1,1-trifluoro-4-imino-4-[3-methyl-4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylphenyl]butan-2-yl]oxidanium.
| Compound Name | [(2S)-2-(3,5-dichlorophenyl)-1,1,1-trifluoro-4-imino-4-[3-methyl-4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylphenyl]butan-2-yl]oxidanium |
|---|---|
| PubChem CID | 148741495 |
| Molecular Formula | C21H19Cl2F6N2O2S+ |
| Molecular Weight | 548.36 g/mol |
| Exact Mass | 547.04 |
| IUPAC Name | [(2S)-2-(3,5-dichlorophenyl)-1,1,1-trifluoro-4-imino-4-[3-methyl-4-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfanylphenyl]butan-2-yl]oxidanium |
| SMILES | [H]/N=C(/C[C@]([OH2+])(c1cc(Cl)cc(Cl)c1)C(F)(F)F)c1ccc(SCC(=O)NCC(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C21H18Cl2F6N2O2S/c1-11-4-12(2-3-17(11)34-9-18(32)31-10-20(24,25)26)16(30)8-19(33,21(27,28)29)13-5-14(22)7-15(23)6-13/h2-7,30,33H,8-10H2,1H3,(H,31,32)/p+1/b30-16-/t19-/m0/s1 |
| InChIKey | OCXVXFNGGUWTPG-CLSXKXNXSA-O |
| XLogP | 6.01 |
| TPSA | 75.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.36 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|