C26H56O8Si3 — CID 148743560
2-methyl-6-[2-[2-[2-[2-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]hex-1-en-3-one (PubChem CID 148743560) has the molecular formula C26H56O8Si3 and a molecular weight of 580.98 g/mol. Its IUPAC name is 2-methyl-6-[2-[2-[2-[2-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]hex-1-en-3-one.
| Compound Name | 2-methyl-6-[2-[2-[2-[2-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]hex-1-en-3-one |
|---|---|
| PubChem CID | 148743560 |
| Molecular Formula | C26H56O8Si3 |
| Molecular Weight | 580.98 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | 2-methyl-6-[2-[2-[2-[2-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]hex-1-en-3-one |
| SMILES | C=C(C)C(=O)CCCOCCOCCOCCOCCOCC(C)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C26H56O8Si3/c1-24(2)26(27)12-11-13-28-14-15-29-16-17-30-18-19-31-20-21-32-22-25(3)23-37(10,33-35(4,5)6)34-36(7,8)9/h25H,1,11-23H2,2-10H3 |
| InChIKey | ODHWTKSRLXUCLL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.98 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|