C28H58O10Si3 — CID 161401489
2-[2-[2-[2-[2-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 5-methyl-4-oxohex-5-enoate (PubChem CID 161401489) has the molecular formula C28H58O10Si3 and a molecular weight of 639.02 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 5-methyl-4-oxohex-5-enoate.
| Compound Name | 2-[2-[2-[2-[2-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 5-methyl-4-oxohex-5-enoate |
|---|---|
| PubChem CID | 161401489 |
| Molecular Formula | C28H58O10Si3 |
| Molecular Weight | 639.02 g/mol |
| Exact Mass | 638.33 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 5-methyl-4-oxohex-5-enoate |
| SMILES | C=C(C)C(=O)CCC(=O)OCCOCCOCCOCCOCCOCC(C)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C28H58O10Si3/c1-25(2)27(29)11-12-28(30)36-22-21-34-18-17-32-14-13-31-15-16-33-19-20-35-23-26(3)24-41(10,37-39(4,5)6)38-40(7,8)9/h26H,1,11-24H2,2-10H3 |
| InChIKey | VUHHPTOPGMFSQF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.02 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|