About 2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane
2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane (PubChem CID 158575016) has the molecular formula C20H46O6Si2
and a molecular weight of 438.75 g/mol. Its IUPAC name is 2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane.
Molecular Properties
| Compound Name | 2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane |
| PubChem CID | 158575016 |
| Molecular Formula | C20H46O6Si2 |
| Molecular Weight | 438.75 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane |
| SMILES | CCCOCC.CCOCCOC(=O)CCC(C)=O.C[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C9H16O4.C6H18OSi2.C5H12O/c1-3-12-6-7-13-9(11)5-4-8(2)10;1-8(2,3)7-9(4,5)6;1-3-5-6-4-2/h3-7H2,1-2H3;1-6H3;3-5H2,1-2H3 |
| InChIKey | HSNZXHIAYBGEJA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.75 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane?
The IUPAC name of 2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane (CID 158575016) is 2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane.
What is the SMILES notation for 2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane?
The canonical SMILES for 2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane is CCCOCC.CCOCCOC(=O)CCC(C)=O.C[Si](C)(C)O[Si](C)(C)C.
What is the InChIKey of 2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane?
The InChIKey is HSNZXHIAYBGEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4.C6H18OSi2.C5H12O/c1-3-12-6-7-13-9(11)5-4-8(2)10;1-8(2,3)7-9(4,5)6;1-3-5-6-4-2/h3-7H2,1-2H3;1-6H3;3-5H2,1-2H3.
What are the key properties of 2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane?
2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane has a molecular weight of 438.75 g/mol, XLogP of 5.04, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl 4-oxopentanoate;1-ethoxypropane;trimethyl(trimethylsilyloxy)silane is sourced from PubChem (CID 158575016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).