C17H36O5Si2 — CID 162082218
6-[2-[3-(hydroxy-methyl-trimethylsilyloxysilyl)-2-methylpropoxy]ethoxy]-2-methylhex-1-en-3-one (PubChem CID 162082218) has the molecular formula C17H36O5Si2 and a molecular weight of 376.64 g/mol. Its IUPAC name is 6-[2-[3-(hydroxy-methyl-trimethylsilyloxysilyl)-2-methylpropoxy]ethoxy]-2-methylhex-1-en-3-one.
| Compound Name | 6-[2-[3-(hydroxy-methyl-trimethylsilyloxysilyl)-2-methylpropoxy]ethoxy]-2-methylhex-1-en-3-one |
|---|---|
| PubChem CID | 162082218 |
| Molecular Formula | C17H36O5Si2 |
| Molecular Weight | 376.64 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 6-[2-[3-(hydroxy-methyl-trimethylsilyloxysilyl)-2-methylpropoxy]ethoxy]-2-methylhex-1-en-3-one |
| SMILES | C=C(C)C(=O)CCCOCCOCC(C)C[Si](C)(O)O[Si](C)(C)C |
| InChI | InChI=1S/C17H36O5Si2/c1-15(2)17(18)9-8-10-20-11-12-21-13-16(3)14-24(7,19)22-23(4,5)6/h16,19H,1,8-14H2,2-7H3 |
| InChIKey | OOFDGOPDMFHDAA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|