C20H42O4Si2 — CID 161267844
6-[2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethoxy]-2-methylhex-1-en-3-one (PubChem CID 161267844) has the molecular formula C20H42O4Si2 and a molecular weight of 402.72 g/mol. Its IUPAC name is 6-[2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethoxy]-2-methylhex-1-en-3-one.
| Compound Name | 6-[2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethoxy]-2-methylhex-1-en-3-one |
|---|---|
| PubChem CID | 161267844 |
| Molecular Formula | C20H42O4Si2 |
| Molecular Weight | 402.72 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 6-[2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethoxy]-2-methylhex-1-en-3-one |
| SMILES | C=C(C)C(=O)CCCOCCOCCC[Si](C)(C)O[Si](C)(C)CCCC |
| InChI | InChI=1S/C20H42O4Si2/c1-8-9-17-25(4,5)24-26(6,7)18-11-14-23-16-15-22-13-10-12-20(21)19(2)3/h2,8-18H2,1,3-7H3 |
| InChIKey | VDKOVXIJGFEJBQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.72 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|