C12H8F10O4 — CID 148743741
bis[(E)-4,4,5,5,5-pentafluoropent-2-enyl] oxalate (PubChem CID 148743741) has the molecular formula C12H8F10O4 and a molecular weight of 406.17 g/mol. Its IUPAC name is bis[(E)-4,4,5,5,5-pentafluoropent-2-enyl] oxalate.
| Compound Name | bis[(E)-4,4,5,5,5-pentafluoropent-2-enyl] oxalate |
|---|---|
| PubChem CID | 148743741 |
| Molecular Formula | C12H8F10O4 |
| Molecular Weight | 406.17 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | bis[(E)-4,4,5,5,5-pentafluoropent-2-enyl] oxalate |
| SMILES | O=C(OC/C=C/C(F)(F)C(F)(F)F)C(=O)OC/C=C/C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F10O4/c13-9(14,11(17,18)19)3-1-5-25-7(23)8(24)26-6-2-4-10(15,16)12(20,21)22/h1-4H,5-6H2/b3-1+,4-2+ |
| InChIKey | ODIXMRRMIAGEDA-ZPUQHVIOSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.17 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|