C45H71N3O6 — CID 148762193
5-[4-[1-[2-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxyethyl]pyrrolidin-3-yl]butyl]-2-(2,6-dioxopiperidin-3-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 148762193) has the molecular formula C45H71N3O6 and a molecular weight of 750.08 g/mol. Its IUPAC name is 5-[4-[1-[2-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxyethyl]pyrrolidin-3-yl]butyl]-2-(2,6-dioxopiperidin-3-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 5-[4-[1-[2-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxyethyl]pyrrolidin-3-yl]butyl]-2-(2,6-dioxopiperidin-3-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 148762193 |
| Molecular Formula | C45H71N3O6 |
| Molecular Weight | 750.08 g/mol |
| Exact Mass | 749.53 |
| IUPAC Name | 5-[4-[1-[2-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxyethyl]pyrrolidin-3-yl]butyl]-2-(2,6-dioxopiperidin-3-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC/C(=C(\C1CCC(O)CC1)C1CCC(OCCN2CCC(CCCCC3CCC4C(=O)N(C5CCC(=O)NC5=O)C(=O)C4C3)C2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C45H71N3O6/c1-2-37(32-10-4-3-5-11-32)42(33-13-17-35(49)18-14-33)34-15-19-36(20-16-34)54-27-26-47-25-24-31(29-47)9-7-6-8-30-12-21-38-39(28-30)45(53)48(44(38)52)40-22-23-41(50)46-43(40)51/h30-36,38-40,49H,2-29H2,1H3,(H,46,50,51)/b42-37- |
| InChIKey | LBPXUQROTPUSEP-POTMTVGHSA-N |
| XLogP | 7.49 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.08 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|