C44H70F2N4O5 — CID 153494198
3-[6-[4-[5-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxy-4,4-difluoropentyl]piperazin-1-yl]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 153494198) has the molecular formula C44H70F2N4O5 and a molecular weight of 773.06 g/mol. Its IUPAC name is 3-[6-[4-[5-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxy-4,4-difluoropentyl]piperazin-1-yl]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[5-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxy-4,4-difluoropentyl]piperazin-1-yl]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 153494198 |
| Molecular Formula | C44H70F2N4O5 |
| Molecular Weight | 773.06 g/mol |
| Exact Mass | 772.53 |
| IUPAC Name | 3-[6-[4-[5-[4-[(Z)-2-cyclohexyl-1-(4-hydroxycyclohexyl)but-1-enyl]cyclohexyl]oxy-4,4-difluoropentyl]piperazin-1-yl]-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC/C(=C(\C1CCC(O)CC1)C1CCC(OCC(F)(F)CCCN2CCN(C3CCC4C(=O)N(C5CCC(=O)NC5=O)CC4C3)CC2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C44H70F2N4O5/c1-2-37(30-7-4-3-5-8-30)41(31-9-14-35(51)15-10-31)32-11-16-36(17-12-32)55-29-44(45,46)21-6-22-48-23-25-49(26-24-48)34-13-18-38-33(27-34)28-50(43(38)54)39-19-20-40(52)47-42(39)53/h30-36,38-39,51H,2-29H2,1H3,(H,47,52,53)/b41-37- |
| InChIKey | KLSCYLNJIZSBSH-PEBWWBBQSA-N |
| XLogP | 6.87 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.06 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|